MCAT Practice · Nomenclature
MCAT Question: What is the IUPAC name for the compound CH3-CH(Cl)-CH2-CH(Cl)-CH3?
medium
What is the IUPAC name for the compound CH3-CH(Cl)-CH2-CH(Cl)-CH3?
More Nomenclature practice questions
What is the IUPAC name for the compound CH3CH2COOCH2CH3?Which of the following is the correct IUPAC name for the compound CH3-CH(Cl)-CH2-CH3?What is the IUPAC name for the compound CH3CH2COOH?What is the IUPAC name for the compound CH3CH2COCl?Which of the following is the correct IUPAC name for the compound CH3-CH2-CH2-CH3?
More from Organic Chemistry
Which of the following factors can affect the solubility of a compound in a solvent?What is the product formed when a carboxylic acid reacts with an alcohol in the presence…Which of the following compounds can undergo Michael addition reactions?Which of the following compounds would exhibit the highest thermodynamic stability of its enolate anion?When 2-methyl-2-propanol is treated with H2SO4 and heated, which of the following compounds is formed predominantly?
Want the full 4,000+ question bank with targeted drills? See pricing.