Organic Chemistry MCAT Practice Questions
536 free Organic Chemistry MCAT-style practice questions, covering topics like Nomenclature, Isomers, Bonding, Analyzing Organic Reactions, Alcohols, Aldehydes and Ketones 1: Electrophilicity and Oxidation/Reduction, and more.
Which of the following reagents is commonly used for the reduction of aldehydes and ketones to alcohols?Which of the following compounds would exhibit keto-enol tautomerism?Which of the following intermediates is most likely involved in the mechanism of an intramolecular aldol condensation?Which of the following compounds is an example of a ketone?Which of the following is the key enzyme responsible for the conversion of ammonia into urea in the urea cycle?Which of the following reagents can be used to selectively oxidize phenol to benzoquinone?Which of the following is the conjugate acid of NH3?When reacting a mixture of a carboxylic acid and an ester with a strong base, which functional group is most…Identify the correct IUPAC name for the following compound: CH3CH2CH(CH3)CH2CH(CH3)CH2CH3A peptide bond forms between which two functional groups?Consider the relationship between bonding and antibonding molecular orbitals and their influence on molecular stability.Which of the following reagents is commonly used to convert a secondary alcohol into a ketone?Which of the following reagents is commonly used as a nucleophile in nucleophilic acyl substitution reactions?Which of the following statements regarding chemical shift in NMR spectroscopy is FALSE?Consider the geometry of the molecule and the number of hybrid orbitals required to accommodate the bonding and lone pairs…Which of the following types of distillation is commonly used to separate volatile compounds from heat-sensitive materials?Which of the following reactions involves the decarboxylation of a carboxylic acid?Which of the following compounds is a structural isomer of CH3CH2CH2CH2CH3 (pentane)?Which of the following statements is true regarding the NMR spectrum of a compound with multiple nonequivalent protons?Which of the following statements accurately describes the coupling constants observed in a ¹H NMR spectrum?Which of the following chromatographic techniques is commonly used to separate charged compounds based on their interactions with a stationary…Which of the following techniques is commonly used to analyze the fragmentation patterns of ions in mass spectrometry?Which of the following correctly applies the IUPAC naming rules?Which of the following reagents is commonly used for the oxidation of aldehydes to carboxylic acids?Which of the following factors affects the nucleophilicity of an atom or molecule?Which of the following factors does NOT affect the chemical shift in NMR spectroscopy?Consider the following reaction: CH3CH2Cl + OH- → CH3CH2OH + Cl- Which of the following statements about this reaction is…Which of the following compounds is a key component of ATP (adenosine triphosphate), a molecule involved in energy storage and…Which of the following quantum numbers determines the energy level or shell of an electron?Which of the following factors can influence the separation in chromatography?In the Gabriel synthesis, what is the role of phthalimide?In the presence of concentrated nitric and sulfuric acids, phenol reacts to form:What is the IUPAC name for the following compound: CH3CH2CH(CH3)CH2CH2OH?Which of the following quantum numbers distinguishes between different orbitals within the same subshell?Which of the following statements is true about enantiomers?Which of the following compounds can form an intramolecular hemiacetal?Which of the following compounds is a structural isomer of CH3COOH (acetic acid)?Which of the following carboxylic acid derivatives undergoes intramolecular acyl substitution reactions?Which of the following is the correct IUPAC name for the compound CH3-CH2-CH2-Br?Which of the following carboxylic acid derivatives is expected to undergo the slowest nucleophilic acyl substitution reaction?Which of the following compounds is most likely to exhibit keto-enol tautomerism?Which of the following regions of the electromagnetic spectrum does ultraviolet (UV) spectroscopy primarily focus on?Which of the following functional groups would exhibit a strong absorption band in the range of 3300-3500 cm-1 in an…Which of the following factors affects the splitting pattern observed in an NMR spectrum?Which of the following techniques is most appropriate for determining the three-dimensional structure of proteins?Which of the following conditions would favor the formation of a hydrate (geminal diol) from an aldehyde?Which of the following statements is true regarding the Beer-Lambert Law as applied to UV spectroscopy?Which of the following solubility-based methods is commonly used to separate enantiomers (optical isomers) of a compound?Consider the phase relationship of the atomic orbitals involved in forming the molecular orbital.Think about the number of electron groups around the central atom in a molecule with trigonal bipyramidal geometry and the…