MyMCATpalSign up free

Organic Chemistry MCAT Practice Questions

536 free Organic Chemistry MCAT-style practice questions, covering topics like Nomenclature, Isomers, Bonding, Analyzing Organic Reactions, Alcohols, Aldehydes and Ketones 1: Electrophilicity and Oxidation/Reduction, and more.

What is the IUPAC name for the compound CH3-CH(Cl)-CH2-CH(Cl)-CH3?Which of the following types of molecular vibrations would result in a change in the dipole moment of a molecule…Which of the following alcohols can form hydrogen bonds with water?Which of the following pairs of compounds are structural isomers?What is the general formula for an aldehyde?What is the IUPAC name for the compound CH3CH2COOH?Consider the arrangement of electron domains around the central atom in molecules with octahedral geometry.Which of the following factors can cause broadening of UV absorption peaks in a spectrum?Which of the following compounds can undergo aldol condensation?Which of the following is the correct IUPAC name for the compound CH3-CH2-COOH?Which of the following substances is considered a Bronsted-Lowry base?When a carboxylic acid reacts with an alcohol in the presence of an acid catalyst, which of the following is…Which of the following amino acids contains a sulfur atom in its side chain?Which of the following alcohols is a primary alcohol?What is the major product when ethylamine reacts with ethanoic anhydride in the presence of a base?Which of the following molecules displays trigonal planar geometry?When a molecule absorbs UV radiation, it undergoes a transition from the ground state to an excited state. Which of…Which of the following reactions involves the cleavage of a carboxylic acid into a carbonyl compound and carbon dioxide?Which of the following is the correct IUPAC name for the compound CH3-CH2-CH2-CH2-CH2-CH3?Which of the following statements is true regarding redox reactions?Which of the following is an oxidizing agent?Which of the following alcohols undergoes oxidation to form a carboxylic acid?Which of the following statements about the oxidation state of carbon in organic compounds is true?Which of the following statements about the reduction of aldehydes and ketones is correct?When treated with LDA followed by addition of ethyl iodide, which of the following ketones will predominantly give the ethylated…Which of the following statements about enolization is true?What is the IUPAC name for the compound CH₃COOCH₂CH₃?Which of the following functional groups is present in all naturally occurring phospholipids?What product is formed when propanal is treated with Tollen's reagent (Ag(NH3)2OH)?Consider the electron configuration: 1s²2s²2p³. How many unpaired electrons are there in the ground state of the atom with this…What is the key characteristic that distinguishes geometric isomers from other types of stereoisomers?Which of the following statements regarding protein structure is true?Which of the following is the correct IUPAC name for the compound CH3-CH2-CH(OH)-CH3?What is the IUPAC name for the compound CH3CH2COCH2CH3?What is the IUPAC name for the compound CH3CHOCHO?What is the IUPAC name for the compound CH3COCH2CHO?Which of the following factors can influence the boiling points of compounds in a distillation process?Which of the following compounds does NOT exhibit optical isomerism?Which of the following statements regarding nucleophilicity and basicity is correct?Which of the following reagents is commonly used for the reduction of aldehydes and ketones to alcohols?Which of the following reactions represents a neutralization reaction?Which of the following compounds is commonly used as a reducing agent in organic chemistry?Which of the following statements about carboxylic acids is true?Which of the following compounds is used as a reagent in the conversion of alcohols to alkyl halides?Which of the following alcohols will undergo oxidation to form a carboxylic acid?Which of the following chromatographic techniques is commonly used to analyze and separate amino acids, peptides, and proteins?Which of the following types of mass spectrometry is commonly used for determining the molecular weight of a compound?Which of the following factors does NOT influence the fragmentation pattern in mass spectrometry?Which of the following compounds is a common component of tooth enamel and bone, providing structural support?Which of the following reactions can convert an alkyl halide to a carboxylic acid?