MyMCATpalSign up free

Organic Chemistry MCAT Practice Questions

536 free Organic Chemistry MCAT-style practice questions, covering topics like Nomenclature, Isomers, Bonding, Analyzing Organic Reactions, Alcohols, Aldehydes and Ketones 1: Electrophilicity and Oxidation/Reduction, and more.

When a carboxylic acid reacts with thionyl chloride (SOCl2), which of the following compounds is primarily formed?Which of the following molecules is most likely to exhibit tautomerism?Which of the following functional groups is present in a carboxylic acid?Which of the following statements is true about peptide bonds?What is the IUPAC name for the compound CH3-CH2-CH(CH3)-CH2-CH3?In a nucleophilic acyl substitution reaction, if a carboxylic acid derivative possesses a substituent with a strong electron-withdrawing group (EWG),…Which of the following compounds is a strong acid but not a carboxylic acid?When benzaldehyde is treated with a strong base and then acidified, which compound is predominantly formed?In a reaction mixture containing an alkene and an alkyne, which reagent would selectively hydrogenate the alkene without affecting the…When a ketone is treated with a strong reducing agent, what is the product?Which of the following statements about the electrophilicity of aldehydes and ketones is correct?When a carboxylic acid is treated with PCl5 (phosphorus pentachloride), which of the following products is formed?Which of the following statements regarding electrophilicity is correct?Which quantum number specifies the orientation of an atomic orbital in space?Which of the following reagents would NOT successfully convert phenol to a phenyl ether?Which of the following compounds can undergo tautomerization?Which of the following electronic transitions in a molecule would be responsible for absorption of UV radiation?Which of the following factors increases the reactivity of carboxylic acid derivatives in nucleophilic acyl substitution reactions?What is the IUPAC name for the compound CH2=CH-CH=CH2?Which of the following is the correct mechanism for the formation of a carboxylic acid from a Grignard reagent and…Which of the following solubility-based methods is commonly used to separate a mixture of gases?Which of the following functional groups can be reduced to form a primary alcohol?Which reagent would most effectively convert benzaldehyde to benzoic acid?Which of the following compounds would show a characteristic absorption peak at around 3300 cm⁻¹ in the infrared spectrum?What is the IUPAC name for the compound CH3-CH(CH3)-OH?Which of the following statements is true regarding the molecular ion peak in a mass spectrum?Which of the following is the correct order of reactivity in nucleophilic acyl substitution reactions for the given carboxylic acid…Which of the following statements regarding the reactivity of phosphorus in organic compounds is FALSE?What is the IUPAC name for the compound CH3COCH2CH2CH3?Which of the following reactions is an example of a dehydration reaction of an alcohol?When a mixture of 2-naphthol and p-nitrophenol is dissolved in water and extracted with dichloromethane, which compound will be found…Which functional group is present in both aldehydes and ketones?During the biosynthesis of the amino acid serine, which enzyme catalyzes the conversion of 3-phosphoglycerate to phosphohydroxypyruvate?Which of the following carboxylic acid derivatives can undergo intermolecular acyl substitution reactions?Which of the following is NOT a correct rule of IUPAC nomenclature?What is the IUPAC name for the compound CH3CH2COOH?Which of the following is the correct IUPAC name for the compound CH3-CH2-C(CH3)2-CH3?What is the general formula for an aldehyde?What is the IUPAC name for the compound CH3COOCH3?What is the IUPAC name for the compound CH3-CH(Cl)-CH2-CH(Cl)-CH3?Which of the following alcohols can form hydrogen bonds with water?In a mass spectrum, which ion would typically exhibit the highest m/z value for a given compound?Which of the following reactions is characteristic of carboxylic acids?Which of the following statements is NOT true regarding nucleophilic acyl substitution reactions?Which of the following factors can influence the separation efficiency in a distillation process?Which of the following substances is classified as a Lewis acid?Which of the following alcohols is chiral?Consider the arrangement of electron domains around the central atom in molecules with octahedral geometry.Which of the following is the correct IUPAC name for the compound CH3-CH2-COOH?Which of the following compounds can undergo aldol condensation?